C10H22B2O4 — CID 144950357
2-methyl-1,3,2-dioxaborolane;2,4,4,5,5-pentamethyl-1,3,2-dioxaborolane (PubChem CID 144950357) has the molecular formula C10H22B2O4 and a molecular weight of 227.91 g/mol. Its IUPAC name is 2-methyl-1,3,2-dioxaborolane;2,4,4,5,5-pentamethyl-1,3,2-dioxaborolane.
| Compound Name | 2-methyl-1,3,2-dioxaborolane;2,4,4,5,5-pentamethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 144950357 |
| Molecular Formula | C10H22B2O4 |
| Molecular Weight | 227.91 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 2-methyl-1,3,2-dioxaborolane;2,4,4,5,5-pentamethyl-1,3,2-dioxaborolane |
| SMILES | CB1OC(C)(C)C(C)(C)O1.CB1OCCO1 |
| InChI | InChI=1S/C7H15BO2.C3H7BO2/c1-6(2)7(3,4)10-8(5)9-6;1-4-5-2-3-6-4/h1-5H3;2-3H2,1H3 |
| InChIKey | BYUDKAULTWSNKZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.91 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|