C9H11F — CID 144950501
(4Z,6Z)-8-fluoro-5-methylocta-4,6-dien-1-yne (PubChem CID 144950501) has the molecular formula C9H11F and a molecular weight of 138.19 g/mol. Its IUPAC name is (4Z,6Z)-8-fluoro-5-methylocta-4,6-dien-1-yne.
| Compound Name | (4Z,6Z)-8-fluoro-5-methylocta-4,6-dien-1-yne |
|---|---|
| PubChem CID | 144950501 |
| Molecular Formula | C9H11F |
| Molecular Weight | 138.19 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | (4Z,6Z)-8-fluoro-5-methylocta-4,6-dien-1-yne |
| SMILES | C#CC/C=C(C)\C=C/CF |
| InChI | InChI=1S/C9H11F/c1-3-4-6-9(2)7-5-8-10/h1,5-7H,4,8H2,2H3/b7-5-,9-6- |
| InChIKey | UZYSTUXVBMEJHX-BSIYMUDXSA-N |
| XLogP | 2.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.19 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|