C18H15F3N8OS — CID 144951489
N,N'-diamino-2-[[5-[5-[8-(trifluoromethyl)quinolin-6-yl]furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]ethanimidamide (PubChem CID 144951489) has the molecular formula C18H15F3N8OS and a molecular weight of 448.43 g/mol. Its IUPAC name is N,N'-diamino-2-[[5-[5-[8-(trifluoromethyl)quinolin-6-yl]furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]ethanimidamide.
| Compound Name | N,N'-diamino-2-[[5-[5-[8-(trifluoromethyl)quinolin-6-yl]furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]ethanimidamide |
|---|---|
| PubChem CID | 144951489 |
| Molecular Formula | C18H15F3N8OS |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | N,N'-diamino-2-[[5-[5-[8-(trifluoromethyl)quinolin-6-yl]furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]ethanimidamide |
| SMILES | N/N=C(/CSc1n[nH]c(-c2ccc(-c3cc(C(F)(F)F)c4ncccc4c3)o2)n1)NN |
| InChI | InChI=1S/C18H15F3N8OS/c19-18(20,21)11-7-10(6-9-2-1-5-24-15(9)11)12-3-4-13(30-12)16-25-17(29-28-16)31-8-14(26-22)27-23/h1-7H,8,22-23H2,(H,26,27)(H,25,28,29) |
| InChIKey | KDPTZKLEKGJVOF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 144.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|