C11H15BN2O2 — CID 144952709
[6-(3-azabicyclo[3.1.0]hexan-3-yl)-5-methyl-3-pyridinyl]boronic acid (PubChem CID 144952709) has the molecular formula C11H15BN2O2 and a molecular weight of 218.06 g/mol. Its IUPAC name is [6-(3-azabicyclo[3.1.0]hexan-3-yl)-5-methyl-3-pyridinyl]boronic acid.
| Compound Name | [6-(3-azabicyclo[3.1.0]hexan-3-yl)-5-methyl-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 144952709 |
| Molecular Formula | C11H15BN2O2 |
| Molecular Weight | 218.06 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | [6-(3-azabicyclo[3.1.0]hexan-3-yl)-5-methyl-3-pyridinyl]boronic acid |
| SMILES | Cc1cc(B(O)O)cnc1N1CC2CC2C1 |
| InChI | InChI=1S/C11H15BN2O2/c1-7-2-10(12(15)16)4-13-11(7)14-5-8-3-9(8)6-14/h2,4,8-9,15-16H,3,5-6H2,1H3 |
| InChIKey | JALOAZCJBMJKMV-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.06 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|