C11H16BN3O2 — CID 68917929
[5-[(1R,5S)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]-3-pyridinyl]boronic acid (PubChem CID 68917929) has the molecular formula C11H16BN3O2 and a molecular weight of 233.08 g/mol. Its IUPAC name is [5-[(1R,5S)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]-3-pyridinyl]boronic acid.
| Compound Name | [5-[(1R,5S)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 68917929 |
| Molecular Formula | C11H16BN3O2 |
| Molecular Weight | 233.08 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | [5-[(1R,5S)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]-3-pyridinyl]boronic acid |
| SMILES | CN1C[C@@H]2CN(c3cncc(B(O)O)c3)C[C@H]21 |
| InChI | InChI=1S/C11H16BN3O2/c1-14-5-8-6-15(7-11(8)14)10-2-9(12(16)17)3-13-4-10/h2-4,8,11,16-17H,5-7H2,1H3/t8-,11-/m1/s1 |
| InChIKey | SSPWSYRTHFPGMW-LDYMZIIASA-N |
| XLogP | -1.49 |
| TPSA | 59.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.08 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|