C18H18N2O3 — CID 144953927
N-benzyl-N-formyl-N'-methyl-2-phenylpropanediamide (PubChem CID 144953927) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is N-benzyl-N-formyl-N'-methyl-2-phenylpropanediamide.
| Compound Name | N-benzyl-N-formyl-N'-methyl-2-phenylpropanediamide |
|---|---|
| PubChem CID | 144953927 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | N-benzyl-N-formyl-N'-methyl-2-phenylpropanediamide |
| SMILES | CNC(=O)C(C(=O)N(C=O)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O3/c1-19-17(22)16(15-10-6-3-7-11-15)18(23)20(13-21)12-14-8-4-2-5-9-14/h2-11,13,16H,12H2,1H3,(H,19,22) |
| InChIKey | LMUOQBLJFQOQNQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|