C10H21N3O — CID 144954121
ethane;(E)-N-methoxy-6-methyl-2,6-diazaspiro[3.4]octan-8-imine (PubChem CID 144954121) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is ethane;(E)-N-methoxy-6-methyl-2,6-diazaspiro[3.4]octan-8-imine.
| Compound Name | ethane;(E)-N-methoxy-6-methyl-2,6-diazaspiro[3.4]octan-8-imine |
|---|---|
| PubChem CID | 144954121 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | ethane;(E)-N-methoxy-6-methyl-2,6-diazaspiro[3.4]octan-8-imine |
| SMILES | CC.CO/N=C1/CN(C)CC12CNC2 |
| InChI | InChI=1S/C8H15N3O.C2H6/c1-11-3-7(10-12-2)8(6-11)4-9-5-8;1-2/h9H,3-6H2,1-2H3;1-2H3/b10-7-; |
| InChIKey | FDIMDNFRXSYWPX-VEZAGKLZSA-N |
| XLogP | 0.55 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|