C28H41FN2O4S+2 — CID 144954420
[2-fluoro-4-[4-(thiomorpholin-1-ium-4-carbonyl)cyclohexen-1-yl]phenyl]-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methyl]oxidanium (PubChem CID 144954420) has the molecular formula C28H41FN2O4S+2 and a molecular weight of 520.71 g/mol. Its IUPAC name is [2-fluoro-4-[4-(thiomorpholin-1-ium-4-carbonyl)cyclohexen-1-yl]phenyl]-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methyl]oxidanium.
| Compound Name | [2-fluoro-4-[4-(thiomorpholin-1-ium-4-carbonyl)cyclohexen-1-yl]phenyl]-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methyl]oxidanium |
|---|---|
| PubChem CID | 144954420 |
| Molecular Formula | C28H41FN2O4S+2 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | [2-fluoro-4-[4-(thiomorpholin-1-ium-4-carbonyl)cyclohexen-1-yl]phenyl]-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methyl]oxidanium |
| SMILES | CC(C)(C)OC(=O)N1CCC(C[OH+]c2ccc(C3=CCC(C(=O)N4CC[SH+]CC4)CC3)cc2F)CC1 |
| InChI | InChI=1S/C28H39FN2O4S/c1-28(2,3)35-27(33)31-12-10-20(11-13-31)19-34-25-9-8-23(18-24(25)29)21-4-6-22(7-5-21)26(32)30-14-16-36-17-15-30/h4,8-9,18,20,22H,5-7,10-17,19H2,1-3H3/p+2 |
| InChIKey | WKOQDKUJYMPGNE-UHFFFAOYSA-P |
| XLogP | 4.55 |
| TPSA | 62.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|