C30H34FN3O6 — CID 129104883
(4-nitrophenyl) 4-[[2-fluoro-4-[4-(pyrrolidine-1-carbonyl)cyclohexen-1-yl]phenoxy]methyl]piperidine-1-carboxylate (PubChem CID 129104883) has the molecular formula C30H34FN3O6 and a molecular weight of 551.62 g/mol. Its IUPAC name is (4-nitrophenyl) 4-[[2-fluoro-4-[4-(pyrrolidine-1-carbonyl)cyclohexen-1-yl]phenoxy]methyl]piperidine-1-carboxylate.
| Compound Name | (4-nitrophenyl) 4-[[2-fluoro-4-[4-(pyrrolidine-1-carbonyl)cyclohexen-1-yl]phenoxy]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 129104883 |
| Molecular Formula | C30H34FN3O6 |
| Molecular Weight | 551.62 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | (4-nitrophenyl) 4-[[2-fluoro-4-[4-(pyrrolidine-1-carbonyl)cyclohexen-1-yl]phenoxy]methyl]piperidine-1-carboxylate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)N1CCC(COc2ccc(C3=CCC(C(=O)N4CCCC4)CC3)cc2F)CC1 |
| InChI | InChI=1S/C30H34FN3O6/c31-27-19-24(22-3-5-23(6-4-22)29(35)32-15-1-2-16-32)7-12-28(27)39-20-21-13-17-33(18-14-21)30(36)40-26-10-8-25(9-11-26)34(37)38/h3,7-12,19,21,23H,1-2,4-6,13-18,20H2 |
| InChIKey | RNIAMTNNQUUKTC-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.62 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|