About cyclopentanol;ethyl 4-amino-6-bromo-7-fluoroquinoline-3-carboxylate
cyclopentanol;ethyl 4-amino-6-bromo-7-fluoroquinoline-3-carboxylate (PubChem CID 144956365) has the molecular formula C17H20BrFN2O3
and a molecular weight of 399.26 g/mol. Its IUPAC name is cyclopentanol;ethyl 4-amino-6-bromo-7-fluoroquinoline-3-carboxylate.
Molecular Properties
| Compound Name | cyclopentanol;ethyl 4-amino-6-bromo-7-fluoroquinoline-3-carboxylate |
| PubChem CID | 144956365 |
| Molecular Formula | C17H20BrFN2O3 |
| Molecular Weight | 399.26 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | cyclopentanol;ethyl 4-amino-6-bromo-7-fluoroquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2cc(F)c(Br)cc2c1N.OC1CCCC1 |
| InChI | InChI=1S/C12H10BrFN2O2.C5H10O/c1-2-18-12(17)7-5-16-10-4-9(14)8(13)3-6(10)11(7)15;6-5-3-1-2-4-5/h3-5H,2H2,1H3,(H2,15,16);5-6H,1-4H2 |
| InChIKey | RSSRNWLUVUVAOH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclopentanol;ethyl 4-amino-6-bromo-7-fluoroquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentanol;ethyl 4-amino-6-bromo-7-fluoroquinoline-3-carboxylate?
The IUPAC name of cyclopentanol;ethyl 4-amino-6-bromo-7-fluoroquinoline-3-carboxylate (CID 144956365) is cyclopentanol;ethyl 4-amino-6-bromo-7-fluoroquinoline-3-carboxylate.
What is the SMILES notation for cyclopentanol;ethyl 4-amino-6-bromo-7-fluoroquinoline-3-carboxylate?
The canonical SMILES for cyclopentanol;ethyl 4-amino-6-bromo-7-fluoroquinoline-3-carboxylate is CCOC(=O)c1cnc2cc(F)c(Br)cc2c1N.OC1CCCC1.
What is the InChIKey of cyclopentanol;ethyl 4-amino-6-bromo-7-fluoroquinoline-3-carboxylate?
The InChIKey is RSSRNWLUVUVAOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrFN2O2.C5H10O/c1-2-18-12(17)7-5-16-10-4-9(14)8(13)3-6(10)11(7)15;6-5-3-1-2-4-5/h3-5H,2H2,1H3,(H2,15,16);5-6H,1-4H2.
What are the key properties of cyclopentanol;ethyl 4-amino-6-bromo-7-fluoroquinoline-3-carboxylate?
cyclopentanol;ethyl 4-amino-6-bromo-7-fluoroquinoline-3-carboxylate has a molecular weight of 399.26 g/mol, XLogP of 3.82, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentanol;ethyl 4-amino-6-bromo-7-fluoroquinoline-3-carboxylate is sourced from PubChem (CID 144956365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).