C15H27N5O2 — CID 144957396
(2R)-2-(2-hydrazinyl-2-methyliminoethyl)-3,3-dimethylbutanoic acid;5-methylpyridin-2-amine (PubChem CID 144957396) has the molecular formula C15H27N5O2 and a molecular weight of 309.41 g/mol. Its IUPAC name is (2R)-2-(2-hydrazinyl-2-methyliminoethyl)-3,3-dimethylbutanoic acid;5-methylpyridin-2-amine.
| Compound Name | (2R)-2-(2-hydrazinyl-2-methyliminoethyl)-3,3-dimethylbutanoic acid;5-methylpyridin-2-amine |
|---|---|
| PubChem CID | 144957396 |
| Molecular Formula | C15H27N5O2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | (2R)-2-(2-hydrazinyl-2-methyliminoethyl)-3,3-dimethylbutanoic acid;5-methylpyridin-2-amine |
| SMILES | C/N=C(/C[C@@H](C(=O)O)C(C)(C)C)NN.Cc1ccc(N)nc1 |
| InChI | InChI=1S/C9H19N3O2.C6H8N2/c1-9(2,3)6(8(13)14)5-7(11-4)12-10;1-5-2-3-6(7)8-4-5/h6H,5,10H2,1-4H3,(H,11,12)(H,13,14);2-4H,1H3,(H2,7,8)/t6-;/m0./s1 |
| InChIKey | PLULBHUFSJBWSH-RGMNGODLSA-N |
| XLogP | 1.59 |
| TPSA | 126.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|