About (2S)-2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;5-methylpyridin-2-amine
(2S)-2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;5-methylpyridin-2-amine (PubChem CID 144957795) has the molecular formula C13H24N6O2
and a molecular weight of 296.38 g/mol. Its IUPAC name is (2S)-2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;5-methylpyridin-2-amine.
Molecular Properties
| Compound Name | (2S)-2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;5-methylpyridin-2-amine |
| PubChem CID | 144957795 |
| Molecular Formula | C13H24N6O2 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (2S)-2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;5-methylpyridin-2-amine |
| SMILES | CCCC(C/C(=N/N)NN)C(=O)O.Cc1ccc(N)nc1 |
| InChI | InChI=1S/C7H16N4O2.C6H8N2/c1-2-3-5(7(12)13)4-6(10-8)11-9;1-5-2-3-6(7)8-4-5/h5H,2-4,8-9H2,1H3,(H,10,11)(H,12,13);2-4H,1H3,(H2,7,8) |
| InChIKey | MZKGHJNKIBGMPV-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 152.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;5-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;5-methylpyridin-2-amine?
The IUPAC name of (2S)-2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;5-methylpyridin-2-amine (CID 144957795) is (2S)-2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;5-methylpyridin-2-amine.
What is the SMILES notation for (2S)-2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;5-methylpyridin-2-amine?
The canonical SMILES for (2S)-2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;5-methylpyridin-2-amine is CCCC(C/C(=N/N)NN)C(=O)O.Cc1ccc(N)nc1.
What is the InChIKey of (2S)-2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;5-methylpyridin-2-amine?
The InChIKey is MZKGHJNKIBGMPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N4O2.C6H8N2/c1-2-3-5(7(12)13)4-6(10-8)11-9;1-5-2-3-6(7)8-4-5/h5H,2-4,8-9H2,1H3,(H,10,11)(H,12,13);2-4H,1H3,(H2,7,8).
What are the key properties of (2S)-2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;5-methylpyridin-2-amine?
(2S)-2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;5-methylpyridin-2-amine has a molecular weight of 296.38 g/mol, XLogP of 0.59, 5 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;5-methylpyridin-2-amine is sourced from PubChem (CID 144957795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).