About 2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;3-methylpyridine
2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;3-methylpyridine (PubChem CID 144957469) has the molecular formula C13H23N5O2
and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;3-methylpyridine.
Molecular Properties
| Compound Name | 2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;3-methylpyridine |
| PubChem CID | 144957469 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;3-methylpyridine |
| SMILES | CCCC(C/C(=N/N)NN)C(=O)O.Cc1cccnc1 |
| InChI | InChI=1S/C7H16N4O2.C6H7N/c1-2-3-5(7(12)13)4-6(10-8)11-9;1-6-3-2-4-7-5-6/h5H,2-4,8-9H2,1H3,(H,10,11)(H,12,13);2-5H,1H3 |
| InChIKey | HNBSZAJBCBMLMX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 126.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;3-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;3-methylpyridine?
The IUPAC name of 2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;3-methylpyridine (CID 144957469) is 2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;3-methylpyridine.
What is the SMILES notation for 2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;3-methylpyridine?
The canonical SMILES for 2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;3-methylpyridine is CCCC(C/C(=N/N)NN)C(=O)O.Cc1cccnc1.
What is the InChIKey of 2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;3-methylpyridine?
The InChIKey is HNBSZAJBCBMLMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N4O2.C6H7N/c1-2-3-5(7(12)13)4-6(10-8)11-9;1-6-3-2-4-7-5-6/h5H,2-4,8-9H2,1H3,(H,10,11)(H,12,13);2-5H,1H3.
What are the key properties of 2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;3-methylpyridine?
2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;3-methylpyridine has a molecular weight of 281.36 g/mol, XLogP of 1.00, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;3-methylpyridine is sourced from PubChem (CID 144957469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).