C13H23N5O2 — CID 144957469
2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;3-methylpyridine (PubChem CID 144957469) has the molecular formula C13H23N5O2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;3-methylpyridine.
| Compound Name | 2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;3-methylpyridine |
|---|---|
| PubChem CID | 144957469 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;3-methylpyridine |
| SMILES | CCCC(C/C(=N/N)NN)C(=O)O.Cc1cccnc1 |
| InChI | InChI=1S/C7H16N4O2.C6H7N/c1-2-3-5(7(12)13)4-6(10-8)11-9;1-6-3-2-4-7-5-6/h5H,2-4,8-9H2,1H3,(H,10,11)(H,12,13);2-5H,1H3 |
| InChIKey | HNBSZAJBCBMLMX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 126.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|