C12H22N4O2S — CID 144957597
2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;2-methylthiophene (PubChem CID 144957597) has the molecular formula C12H22N4O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is 2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;2-methylthiophene.
| Compound Name | 2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;2-methylthiophene |
|---|---|
| PubChem CID | 144957597 |
| Molecular Formula | C12H22N4O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 2-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]pentanoic acid;2-methylthiophene |
| SMILES | CCCC(C/C(=N/N)NN)C(=O)O.Cc1cccs1 |
| InChI | InChI=1S/C7H16N4O2.C5H6S/c1-2-3-5(7(12)13)4-6(10-8)11-9;1-5-3-2-4-6-5/h5H,2-4,8-9H2,1H3,(H,10,11)(H,12,13);2-4H,1H3 |
| InChIKey | UCTNSGIMTJSSOH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|