C26H39BrN4O3 — CID 144957557
1-bromo-3-methylbenzene;tert-butyl 2-[(2Z)-2-amino-2-[amino-[(4-methoxyphenyl)methyl]hydrazinylidene]ethyl]pentanoate (PubChem CID 144957557) has the molecular formula C26H39BrN4O3 and a molecular weight of 535.53 g/mol. Its IUPAC name is 1-bromo-3-methylbenzene;tert-butyl 2-[(2Z)-2-amino-2-[amino-[(4-methoxyphenyl)methyl]hydrazinylidene]ethyl]pentanoate.
| Compound Name | 1-bromo-3-methylbenzene;tert-butyl 2-[(2Z)-2-amino-2-[amino-[(4-methoxyphenyl)methyl]hydrazinylidene]ethyl]pentanoate |
|---|---|
| PubChem CID | 144957557 |
| Molecular Formula | C26H39BrN4O3 |
| Molecular Weight | 535.53 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | 1-bromo-3-methylbenzene;tert-butyl 2-[(2Z)-2-amino-2-[amino-[(4-methoxyphenyl)methyl]hydrazinylidene]ethyl]pentanoate |
| SMILES | CCCC(C/C(N)=N/N(N)Cc1ccc(OC)cc1)C(=O)OC(C)(C)C.Cc1cccc(Br)c1 |
| InChI | InChI=1S/C19H32N4O3.C7H7Br/c1-6-7-15(18(24)26-19(2,3)4)12-17(20)22-23(21)13-14-8-10-16(25-5)11-9-14;1-6-3-2-4-7(8)5-6/h8-11,15H,6-7,12-13,21H2,1-5H3,(H2,20,22);2-5H,1H3 |
| InChIKey | BCMACUNXPAUADX-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|