C18H24BrN5O3S — CID 144893841
N'-[amino-[(4-methoxyphenyl)methyl]amino]-2-bromo-6-sulfamoylbenzenecarboximidamide;prop-1-ene (PubChem CID 144893841) has the molecular formula C18H24BrN5O3S and a molecular weight of 470.39 g/mol. Its IUPAC name is N'-[amino-[(4-methoxyphenyl)methyl]amino]-2-bromo-6-sulfamoylbenzenecarboximidamide;prop-1-ene.
| Compound Name | N'-[amino-[(4-methoxyphenyl)methyl]amino]-2-bromo-6-sulfamoylbenzenecarboximidamide;prop-1-ene |
|---|---|
| PubChem CID | 144893841 |
| Molecular Formula | C18H24BrN5O3S |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | N'-[amino-[(4-methoxyphenyl)methyl]amino]-2-bromo-6-sulfamoylbenzenecarboximidamide;prop-1-ene |
| SMILES | C=CC.COc1ccc(CN(N)/N=C(\N)c2c(Br)cccc2S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H18BrN5O3S.C3H6/c1-24-11-7-5-10(6-8-11)9-21(18)20-15(17)14-12(16)3-2-4-13(14)25(19,22)23;1-3-2/h2-8H,9,18H2,1H3,(H2,17,20)(H2,19,22,23);3H,1H2,2H3 |
| InChIKey | PBMVCVURUCANFU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 137.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|