C22H32N6O2S — CID 144957833
(2S)-2-[(1Z,2S)-1-amino-1-(aminohydrazinylidene)-3-[4-(2-piperidin-1-yl-1,3-thiazol-5-yl)phenyl]propan-2-yl]pentanoic acid (PubChem CID 144957833) has the molecular formula C22H32N6O2S and a molecular weight of 444.61 g/mol. Its IUPAC name is (2S)-2-[(1Z,2S)-1-amino-1-(aminohydrazinylidene)-3-[4-(2-piperidin-1-yl-1,3-thiazol-5-yl)phenyl]propan-2-yl]pentanoic acid.
| Compound Name | (2S)-2-[(1Z,2S)-1-amino-1-(aminohydrazinylidene)-3-[4-(2-piperidin-1-yl-1,3-thiazol-5-yl)phenyl]propan-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 144957833 |
| Molecular Formula | C22H32N6O2S |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | (2S)-2-[(1Z,2S)-1-amino-1-(aminohydrazinylidene)-3-[4-(2-piperidin-1-yl-1,3-thiazol-5-yl)phenyl]propan-2-yl]pentanoic acid |
| SMILES | CCC[C@H](C(=O)O)[C@H](Cc1ccc(-c2cnc(N3CCCCC3)s2)cc1)/C(N)=N/NN |
| InChI | InChI=1S/C22H32N6O2S/c1-2-6-17(21(29)30)18(20(23)26-27-24)13-15-7-9-16(10-8-15)19-14-25-22(31-19)28-11-4-3-5-12-28/h7-10,14,17-18,27H,2-6,11-13,24H2,1H3,(H2,23,26)(H,29,30)/t17-,18-/m0/s1 |
| InChIKey | RGIBBWAJCUUKSF-ROUUACIJSA-N |
| XLogP | 3.20 |
| TPSA | 129.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|