C15H16FN3OS — CID 46907745
1-[5-(3-fluorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide (PubChem CID 46907745) has the molecular formula C15H16FN3OS and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-[5-(3-fluorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[5-(3-fluorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46907745 |
| Molecular Formula | C15H16FN3OS |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 1-[5-(3-fluorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(c2ncc(-c3cccc(F)c3)s2)CC1 |
| InChI | InChI=1S/C15H16FN3OS/c16-12-3-1-2-11(8-12)13-9-18-15(21-13)19-6-4-10(5-7-19)14(17)20/h1-3,8-10H,4-7H2,(H2,17,20) |
| InChIKey | JJRYOSRUJQWEBM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |