C20H23N5O2S2 — CID 142825072
4-[4-[5-(4-cyanophenyl)-1,3-thiazol-2-yl]piperazin-1-yl]sulfanyloxane-4-carboxamide (PubChem CID 142825072) has the molecular formula C20H23N5O2S2 and a molecular weight of 429.57 g/mol. Its IUPAC name is 4-[4-[5-(4-cyanophenyl)-1,3-thiazol-2-yl]piperazin-1-yl]sulfanyloxane-4-carboxamide.
| Compound Name | 4-[4-[5-(4-cyanophenyl)-1,3-thiazol-2-yl]piperazin-1-yl]sulfanyloxane-4-carboxamide |
|---|---|
| PubChem CID | 142825072 |
| Molecular Formula | C20H23N5O2S2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 4-[4-[5-(4-cyanophenyl)-1,3-thiazol-2-yl]piperazin-1-yl]sulfanyloxane-4-carboxamide |
| SMILES | N#Cc1ccc(-c2cnc(N3CCN(SC4(C(N)=O)CCOCC4)CC3)s2)cc1 |
| InChI | InChI=1S/C20H23N5O2S2/c21-13-15-1-3-16(4-2-15)17-14-23-19(28-17)24-7-9-25(10-8-24)29-20(18(22)26)5-11-27-12-6-20/h1-4,14H,5-12H2,(H2,22,26) |
| InChIKey | YCBAPDBXEGXBLU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|