C23H30N4O2S2 — CID 142824936
4-[4-[4-(3-methylphenyl)-1,3-thiazol-2-yl]piperazin-1-yl]sulfanyloxane-4-carboxamide;prop-1-yne (PubChem CID 142824936) has the molecular formula C23H30N4O2S2 and a molecular weight of 458.65 g/mol. Its IUPAC name is 4-[4-[4-(3-methylphenyl)-1,3-thiazol-2-yl]piperazin-1-yl]sulfanyloxane-4-carboxamide;prop-1-yne.
| Compound Name | 4-[4-[4-(3-methylphenyl)-1,3-thiazol-2-yl]piperazin-1-yl]sulfanyloxane-4-carboxamide;prop-1-yne |
|---|---|
| PubChem CID | 142824936 |
| Molecular Formula | C23H30N4O2S2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 4-[4-[4-(3-methylphenyl)-1,3-thiazol-2-yl]piperazin-1-yl]sulfanyloxane-4-carboxamide;prop-1-yne |
| SMILES | C#CC.Cc1cccc(-c2csc(N3CCN(SC4(C(N)=O)CCOCC4)CC3)n2)c1 |
| InChI | InChI=1S/C20H26N4O2S2.C3H4/c1-15-3-2-4-16(13-15)17-14-27-19(22-17)23-7-9-24(10-8-23)28-20(18(21)25)5-11-26-12-6-20;1-3-2/h2-4,13-14H,5-12H2,1H3,(H2,21,25);1H,2H3 |
| InChIKey | KPOCXLHCNOPEBC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|