C28H40BN3O7S — CID 144958399
(2S)-4-(3-ethoxy-1-ethylpyrazol-4-yl)sulfonyl-2-(3-methoxybut-3-enyl)-6-[(E)-2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)ethenyl]-2,3-dihydro-1,4-benzoxazine (PubChem CID 144958399) has the molecular formula C28H40BN3O7S and a molecular weight of 573.52 g/mol. Its IUPAC name is (2S)-4-(3-ethoxy-1-ethylpyrazol-4-yl)sulfonyl-2-(3-methoxybut-3-enyl)-6-[(E)-2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)ethenyl]-2,3-dihydro-1,4-benzoxazine.
| Compound Name | (2S)-4-(3-ethoxy-1-ethylpyrazol-4-yl)sulfonyl-2-(3-methoxybut-3-enyl)-6-[(E)-2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)ethenyl]-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 144958399 |
| Molecular Formula | C28H40BN3O7S |
| Molecular Weight | 573.52 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | (2S)-4-(3-ethoxy-1-ethylpyrazol-4-yl)sulfonyl-2-(3-methoxybut-3-enyl)-6-[(E)-2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)ethenyl]-2,3-dihydro-1,4-benzoxazine |
| SMILES | C=C(CC[C@H]1CN(S(=O)(=O)c2cn(CC)nc2OCC)c2cc(/C=C/B3OC(C)CC(C)(C)O3)ccc2O1)OC |
| InChI | InChI=1S/C28H40BN3O7S/c1-8-31-19-26(27(30-31)36-9-2)40(33,34)32-18-23(12-10-20(3)35-7)37-25-13-11-22(16-24(25)32)14-15-29-38-21(4)17-28(5,6)39-29/h11,13-16,19,21,23H,3,8-10,12,17-18H2,1-2,4-7H3/b15-14+/t21?,23-/m0/s1 |
| InChIKey | FBRKFGGYODUCIS-QHGFTFSMSA-N |
| XLogP | 4.84 |
| TPSA | 101.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|