C21H28F2N6OS — CID 144959243
(2R)-2-(2,5-difluorophenyl)-5-[2-(4-methylpiperazin-1-yl)sulfanyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]oxan-3-amine (PubChem CID 144959243) has the molecular formula C21H28F2N6OS and a molecular weight of 450.56 g/mol. Its IUPAC name is (2R)-2-(2,5-difluorophenyl)-5-[2-(4-methylpiperazin-1-yl)sulfanyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]oxan-3-amine.
| Compound Name | (2R)-2-(2,5-difluorophenyl)-5-[2-(4-methylpiperazin-1-yl)sulfanyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]oxan-3-amine |
|---|---|
| PubChem CID | 144959243 |
| Molecular Formula | C21H28F2N6OS |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | (2R)-2-(2,5-difluorophenyl)-5-[2-(4-methylpiperazin-1-yl)sulfanyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]oxan-3-amine |
| SMILES | CN1CCN(Sn2cc3c(n2)CN(C2CO[C@H](c4cc(F)ccc4F)C(N)C2)C3)CC1 |
| InChI | InChI=1S/C21H28F2N6OS/c1-26-4-6-28(7-5-26)31-29-11-14-10-27(12-20(14)25-29)16-9-19(24)21(30-13-16)17-8-15(22)2-3-18(17)23/h2-3,8,11,16,19,21H,4-7,9-10,12-13,24H2,1H3/t16?,19?,21-/m1/s1 |
| InChIKey | HARCAWDFOCZYDN-VFIGECHUSA-N |
| XLogP | 1.99 |
| TPSA | 62.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|