C16H20Cl2F2N4O — CID 25205613
(2R,3S,5R)-2-(2,5-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)oxan-3-amine;dihydrochloride (PubChem CID 25205613) has the molecular formula C16H20Cl2F2N4O and a molecular weight of 393.27 g/mol. Its IUPAC name is (2R,3S,5R)-2-(2,5-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)oxan-3-amine;dihydrochloride.
| Compound Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)oxan-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 25205613 |
| Molecular Formula | C16H20Cl2F2N4O |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)oxan-3-amine;dihydrochloride |
| SMILES | Cl.Cl.N[C@H]1C[C@@H](N2Cc3cn[nH]c3C2)CO[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C16H18F2N4O.2ClH/c17-10-1-2-13(18)12(3-10)16-14(19)4-11(8-23-16)22-6-9-5-20-21-15(9)7-22;;/h1-3,5,11,14,16H,4,6-8,19H2,(H,20,21);2*1H/t11-,14+,16-;;/m1../s1 |
| InChIKey | UFLXBTOVPRBSCI-FLFAIEEQSA-N |
| XLogP | 2.70 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |