C17H17F5N4O3S — CID 171342630
(2R,3S,5R)-2-(2,5-difluorophenyl)-5-[1-(trifluoromethylsulfonyl)-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl]oxan-3-amine (PubChem CID 171342630) has the molecular formula C17H17F5N4O3S and a molecular weight of 452.41 g/mol. Its IUPAC name is (2R,3S,5R)-2-(2,5-difluorophenyl)-5-[1-(trifluoromethylsulfonyl)-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl]oxan-3-amine.
| Compound Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-[1-(trifluoromethylsulfonyl)-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl]oxan-3-amine |
|---|---|
| PubChem CID | 171342630 |
| Molecular Formula | C17H17F5N4O3S |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-[1-(trifluoromethylsulfonyl)-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl]oxan-3-amine |
| SMILES | N[C@H]1C[C@@H](N2Cc3cnn(S(=O)(=O)C(F)(F)F)c3C2)CO[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C17H17F5N4O3S/c18-10-1-2-13(19)12(3-10)16-14(23)4-11(8-29-16)25-6-9-5-24-26(15(9)7-25)30(27,28)17(20,21)22/h1-3,5,11,14,16H,4,6-8,23H2/t11-,14+,16-/m1/s1 |
| InChIKey | KHGDWAXLKTXTMG-DIOULYMOSA-N |
| XLogP | 2.03 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |