C19H22F2N4O — CID 118614049
(2R,3S,5R)-2-(2,5-difluorophenyl)-5-(1,4,7-triazatricyclo[6.3.0.02,6]undeca-2(6),7-dien-4-yl)oxan-3-amine (PubChem CID 118614049) has the molecular formula C19H22F2N4O and a molecular weight of 360.41 g/mol. Its IUPAC name is (2R,3S,5R)-2-(2,5-difluorophenyl)-5-(1,4,7-triazatricyclo[6.3.0.02,6]undeca-2(6),7-dien-4-yl)oxan-3-amine.
| Compound Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-(1,4,7-triazatricyclo[6.3.0.02,6]undeca-2(6),7-dien-4-yl)oxan-3-amine |
|---|---|
| PubChem CID | 118614049 |
| Molecular Formula | C19H22F2N4O |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-(1,4,7-triazatricyclo[6.3.0.02,6]undeca-2(6),7-dien-4-yl)oxan-3-amine |
| SMILES | N[C@H]1C[C@@H](N2Cc3nc4n(c3C2)CCC4)CO[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C19H22F2N4O/c20-11-3-4-14(21)13(6-11)19-15(22)7-12(10-26-19)24-8-16-17(9-24)25-5-1-2-18(25)23-16/h3-4,6,12,15,19H,1-2,5,7-10,22H2/t12-,15+,19-/m1/s1 |
| InChIKey | VHFJDJODZRVOOZ-XFHNUULXSA-N |
| XLogP | 2.28 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |