C21H22F5N7O — CID 118614037
(2R,3S,5R)-2-(2,5-difluorophenyl)-5-[3-methyl-2-[2-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]oxan-3-amine (PubChem CID 118614037) has the molecular formula C21H22F5N7O and a molecular weight of 483.45 g/mol. Its IUPAC name is (2R,3S,5R)-2-(2,5-difluorophenyl)-5-[3-methyl-2-[2-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]oxan-3-amine.
| Compound Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-[3-methyl-2-[2-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]oxan-3-amine |
|---|---|
| PubChem CID | 118614037 |
| Molecular Formula | C21H22F5N7O |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-[3-methyl-2-[2-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]oxan-3-amine |
| SMILES | Cn1nc(C(F)(F)F)nc1-c1nc2c(n1C)CN([C@H]1CO[C@H](c3cc(F)ccc3F)[C@@H](N)C1)C2 |
| InChI | InChI=1S/C21H22F5N7O/c1-31-16-8-33(7-15(16)28-18(31)19-29-20(21(24,25)26)30-32(19)2)11-6-14(27)17(34-9-11)12-5-10(22)3-4-13(12)23/h3-5,11,14,17H,6-9,27H2,1-2H3/t11-,14+,17-/m1/s1 |
| InChIKey | DMZQSWJKGALNMD-HYSWKAIVSA-N |
| XLogP | 2.69 |
| TPSA | 87.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |