C21H23F2N5O2 — CID 118614327
(2R,3S,5R)-2-(2,5-difluorophenyl)-5-[3-methyl-2-(4-methyl-1,3-oxazol-2-yl)-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]oxan-3-amine (PubChem CID 118614327) has the molecular formula C21H23F2N5O2 and a molecular weight of 415.44 g/mol. Its IUPAC name is (2R,3S,5R)-2-(2,5-difluorophenyl)-5-[3-methyl-2-(4-methyl-1,3-oxazol-2-yl)-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]oxan-3-amine.
| Compound Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-[3-methyl-2-(4-methyl-1,3-oxazol-2-yl)-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]oxan-3-amine |
|---|---|
| PubChem CID | 118614327 |
| Molecular Formula | C21H23F2N5O2 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-[3-methyl-2-(4-methyl-1,3-oxazol-2-yl)-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]oxan-3-amine |
| SMILES | Cc1coc(-c2nc3c(n2C)CN([C@H]2CO[C@H](c4cc(F)ccc4F)[C@@H](N)C2)C3)n1 |
| InChI | InChI=1S/C21H23F2N5O2/c1-11-9-30-21(25-11)20-26-17-7-28(8-18(17)27(20)2)13-6-16(24)19(29-10-13)14-5-12(22)3-4-15(14)23/h3-5,9,13,16,19H,6-8,10,24H2,1-2H3/t13-,16+,19-/m1/s1 |
| InChIKey | MXABLTMDSGBRHE-ACWOFJMJSA-N |
| XLogP | 2.83 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |