C22H29F2N5O2 — CID 118614221
5-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-N,N-dimethyl-3-propan-2-yl-4,6-dihydropyrrolo[3,4-d]imidazole-2-carboxamide (PubChem CID 118614221) has the molecular formula C22H29F2N5O2 and a molecular weight of 433.50 g/mol. Its IUPAC name is 5-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-N,N-dimethyl-3-propan-2-yl-4,6-dihydropyrrolo[3,4-d]imidazole-2-carboxamide.
| Compound Name | 5-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-N,N-dimethyl-3-propan-2-yl-4,6-dihydropyrrolo[3,4-d]imidazole-2-carboxamide |
|---|---|
| PubChem CID | 118614221 |
| Molecular Formula | C22H29F2N5O2 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 5-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-N,N-dimethyl-3-propan-2-yl-4,6-dihydropyrrolo[3,4-d]imidazole-2-carboxamide |
| SMILES | CC(C)n1c(C(=O)N(C)C)nc2c1CN([C@H]1CO[C@H](c3cc(F)ccc3F)[C@@H](N)C1)C2 |
| InChI | InChI=1S/C22H29F2N5O2/c1-12(2)29-19-10-28(9-18(19)26-21(29)22(30)27(3)4)14-8-17(25)20(31-11-14)15-7-13(23)5-6-16(15)24/h5-7,12,14,17,20H,8-11,25H2,1-4H3/t14-,17+,20-/m1/s1 |
| InChIKey | ZFBRNTYFCLQRTE-CFLQYTFWSA-N |
| XLogP | 2.62 |
| TPSA | 76.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |