C25H42F2N8O — CID 144979355
5-[(6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-N'-[amino(methyl)amino]-3-propan-2-yl-4,6-dihydropyrrolo[3,4-d]imidazole-2-carboximidamide;ethane (PubChem CID 144979355) has the molecular formula C25H42F2N8O and a molecular weight of 508.66 g/mol. Its IUPAC name is 5-[(6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-N'-[amino(methyl)amino]-3-propan-2-yl-4,6-dihydropyrrolo[3,4-d]imidazole-2-carboximidamide;ethane.
| Compound Name | 5-[(6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-N'-[amino(methyl)amino]-3-propan-2-yl-4,6-dihydropyrrolo[3,4-d]imidazole-2-carboximidamide;ethane |
|---|---|
| PubChem CID | 144979355 |
| Molecular Formula | C25H42F2N8O |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.34 |
| IUPAC Name | 5-[(6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-N'-[amino(methyl)amino]-3-propan-2-yl-4,6-dihydropyrrolo[3,4-d]imidazole-2-carboximidamide;ethane |
| SMILES | CC.CC.CC(C)n1c(/C(N)=N/N(C)N)nc2c1CN(C1CO[C@H](c3cc(F)ccc3F)C(N)C1)C2 |
| InChI | InChI=1S/C21H30F2N8O.2C2H6/c1-11(2)31-18-9-30(8-17(18)27-21(31)20(25)28-29(3)26)13-7-16(24)19(32-10-13)14-6-12(22)4-5-15(14)23;2*1-2/h4-6,11,13,16,19H,7-10,24,26H2,1-3H3,(H2,25,28);2*1-2H3/t13?,16?,19-;;/m1../s1 |
| InChIKey | ISNVOCFBLIQUBD-FNWHOGJCSA-N |
| XLogP | 3.39 |
| TPSA | 123.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|