C24H33F2N5O2 — CID 118614203
5-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-N,N-diethyl-3-propan-2-yl-4,6-dihydropyrrolo[3,4-d]imidazole-2-carboxamide (PubChem CID 118614203) has the molecular formula C24H33F2N5O2 and a molecular weight of 461.56 g/mol. Its IUPAC name is 5-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-N,N-diethyl-3-propan-2-yl-4,6-dihydropyrrolo[3,4-d]imidazole-2-carboxamide.
| Compound Name | 5-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-N,N-diethyl-3-propan-2-yl-4,6-dihydropyrrolo[3,4-d]imidazole-2-carboxamide |
|---|---|
| PubChem CID | 118614203 |
| Molecular Formula | C24H33F2N5O2 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | 5-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-N,N-diethyl-3-propan-2-yl-4,6-dihydropyrrolo[3,4-d]imidazole-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1nc2c(n1C(C)C)CN([C@H]1CO[C@H](c3cc(F)ccc3F)[C@@H](N)C1)C2 |
| InChI | InChI=1S/C24H33F2N5O2/c1-5-29(6-2)24(32)23-28-20-11-30(12-21(20)31(23)14(3)4)16-10-19(27)22(33-13-16)17-9-15(25)7-8-18(17)26/h7-9,14,16,19,22H,5-6,10-13,27H2,1-4H3/t16-,19+,22-/m1/s1 |
| InChIKey | VQEUHBVMMPXNRB-GTCCEBARSA-N |
| XLogP | 3.40 |
| TPSA | 76.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |