C19H20F4N8O — CID 118614025
(2R,3S,5R)-5-[3-(difluoromethyl)-2-(2-methyltetrazol-5-yl)-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]-2-(2,5-difluorophenyl)oxan-3-amine (PubChem CID 118614025) has the molecular formula C19H20F4N8O and a molecular weight of 452.42 g/mol. Its IUPAC name is (2R,3S,5R)-5-[3-(difluoromethyl)-2-(2-methyltetrazol-5-yl)-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]-2-(2,5-difluorophenyl)oxan-3-amine.
| Compound Name | (2R,3S,5R)-5-[3-(difluoromethyl)-2-(2-methyltetrazol-5-yl)-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]-2-(2,5-difluorophenyl)oxan-3-amine |
|---|---|
| PubChem CID | 118614025 |
| Molecular Formula | C19H20F4N8O |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | (2R,3S,5R)-5-[3-(difluoromethyl)-2-(2-methyltetrazol-5-yl)-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]-2-(2,5-difluorophenyl)oxan-3-amine |
| SMILES | Cn1nnc(-c2nc3c(n2C(F)F)CN([C@H]2CO[C@H](c4cc(F)ccc4F)[C@@H](N)C2)C3)n1 |
| InChI | InChI=1S/C19H20F4N8O/c1-29-27-17(26-28-29)18-25-14-6-30(7-15(14)31(18)19(22)23)10-5-13(24)16(32-8-10)11-4-9(20)2-3-12(11)21/h2-4,10,13,16,19H,5-8,24H2,1H3/t10-,13+,16-/m1/s1 |
| InChIKey | CUTUWVIBUCUFLV-AKWBHNSASA-N |
| XLogP | 1.92 |
| TPSA | 99.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |