C19H21F5N4O2 — CID 67964954
(2S)-3-[5-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl]-1,1,1-trifluoropropan-2-ol (PubChem CID 67964954) has the molecular formula C19H21F5N4O2 and a molecular weight of 432.39 g/mol. Its IUPAC name is (2S)-3-[5-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2S)-3-[5-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 67964954 |
| Molecular Formula | C19H21F5N4O2 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | (2S)-3-[5-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl]-1,1,1-trifluoropropan-2-ol |
| SMILES | N[C@H]1C[C@@H](N2Cc3cn(C[C@H](O)C(F)(F)F)nc3C2)CO[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C19H21F5N4O2/c20-11-1-2-14(21)13(3-11)18-15(25)4-12(9-30-18)27-5-10-6-28(26-16(10)7-27)8-17(29)19(22,23)24/h1-3,6,12,15,17-18,29H,4-5,7-9,25H2/t12-,15+,17+,18-/m1/s1 |
| InChIKey | AQVWVLVYYLQCFQ-BGIURUKPSA-N |
| XLogP | 2.26 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |