C19H24F5N3O — CID 144608129
(2R,5R)-2-(2,5-difluorophenyl)-5-[2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]oxan-3-amine (PubChem CID 144608129) has the molecular formula C19H24F5N3O and a molecular weight of 405.41 g/mol. Its IUPAC name is (2R,5R)-2-(2,5-difluorophenyl)-5-[2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]oxan-3-amine.
| Compound Name | (2R,5R)-2-(2,5-difluorophenyl)-5-[2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]oxan-3-amine |
|---|---|
| PubChem CID | 144608129 |
| Molecular Formula | C19H24F5N3O |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (2R,5R)-2-(2,5-difluorophenyl)-5-[2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]oxan-3-amine |
| SMILES | NC1C[C@@H](N2CC3CN(CC(F)(F)F)CC3C2)CO[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C19H24F5N3O/c20-13-1-2-16(21)15(3-13)18-17(25)4-14(9-28-18)27-7-11-5-26(6-12(11)8-27)10-19(22,23)24/h1-3,11-12,14,17-18H,4-10,25H2/t11?,12?,14-,17?,18-/m1/s1 |
| InChIKey | JJFVKSIWSRZRCV-XGYKMFNCSA-N |
| XLogP | 2.55 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |