C22H33F2N3O — CID 118340964
2-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-N-(2-methylpropyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 118340964) has the molecular formula C22H33F2N3O and a molecular weight of 393.52 g/mol. Its IUPAC name is 2-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-N-(2-methylpropyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | 2-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-N-(2-methylpropyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 118340964 |
| Molecular Formula | C22H33F2N3O |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | 2-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-N-(2-methylpropyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | CC(C)CNC1CC2CN([C@H]3CO[C@H](c4cc(F)ccc4F)[C@@H](N)C3)CC2C1 |
| InChI | InChI=1S/C22H33F2N3O/c1-13(2)9-26-17-5-14-10-27(11-15(14)6-17)18-8-21(25)22(28-12-18)19-7-16(23)3-4-20(19)24/h3-4,7,13-15,17-18,21-22,26H,5-6,8-12,25H2,1-2H3/t14?,15?,17?,18-,21+,22-/m1/s1 |
| InChIKey | HXTAXPFQRFRGOD-ZQDLIENUSA-N |
| XLogP | 3.08 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |