C22H30F2N4O2 — CID 118340970
1-[2-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-3-cyclopropylurea (PubChem CID 118340970) has the molecular formula C22H30F2N4O2 and a molecular weight of 420.50 g/mol. Its IUPAC name is 1-[2-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-3-cyclopropylurea.
| Compound Name | 1-[2-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-3-cyclopropylurea |
|---|---|
| PubChem CID | 118340970 |
| Molecular Formula | C22H30F2N4O2 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 1-[2-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-3-cyclopropylurea |
| SMILES | N[C@H]1C[C@@H](N2CC3CC(NC(=O)NC4CC4)CC3C2)CO[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C22H30F2N4O2/c23-14-1-4-19(24)18(7-14)21-20(25)8-17(11-30-21)28-9-12-5-16(6-13(12)10-28)27-22(29)26-15-2-3-15/h1,4,7,12-13,15-17,20-21H,2-3,5-6,8-11,25H2,(H2,26,27,29)/t12?,13?,16?,17-,20+,21-/m1/s1 |
| InChIKey | YXPVUNWPXLRBMP-NJRHHBHGSA-N |
| XLogP | 2.29 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |