C22H28F2N2O2 — CID 118351344
1-[2-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-3,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrol-5-yl]-2-methylpropan-1-one (PubChem CID 118351344) has the molecular formula C22H28F2N2O2 and a molecular weight of 390.47 g/mol. Its IUPAC name is 1-[2-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-3,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrol-5-yl]-2-methylpropan-1-one.
| Compound Name | 1-[2-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-3,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrol-5-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 118351344 |
| Molecular Formula | C22H28F2N2O2 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 1-[2-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-3,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrol-5-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)C1CC2=C(C1)CN([C@H]1CO[C@H](c3cc(F)ccc3F)[C@@H](N)C1)C2 |
| InChI | InChI=1S/C22H28F2N2O2/c1-12(2)21(27)13-5-14-9-26(10-15(14)6-13)17-8-20(25)22(28-11-17)18-7-16(23)3-4-19(18)24/h3-4,7,12-13,17,20,22H,5-6,8-11,25H2,1-2H3/t17-,20+,22-/m1/s1 |
| InChIKey | CXLJECYUXXPVEU-PIPMEXSNSA-N |
| XLogP | 3.37 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|