C23H24F3N3O3S — CID 123741205
2-(2,5-difluorophenyl)-5-[5-(4-fluorophenyl)sulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]oxan-3-amine (PubChem CID 123741205) has the molecular formula C23H24F3N3O3S and a molecular weight of 479.52 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-5-[5-(4-fluorophenyl)sulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]oxan-3-amine.
| Compound Name | 2-(2,5-difluorophenyl)-5-[5-(4-fluorophenyl)sulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]oxan-3-amine |
|---|---|
| PubChem CID | 123741205 |
| Molecular Formula | C23H24F3N3O3S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 2-(2,5-difluorophenyl)-5-[5-(4-fluorophenyl)sulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]oxan-3-amine |
| SMILES | NC1CC(N2CC3=C(C2)CN(S(=O)(=O)c2ccc(F)cc2)C3)COC1c1cc(F)ccc1F |
| InChI | InChI=1S/C23H24F3N3O3S/c24-16-1-4-19(5-2-16)33(30,31)29-11-14-9-28(10-15(14)12-29)18-8-22(27)23(32-13-18)20-7-17(25)3-6-21(20)26/h1-7,18,22-23H,8-13,27H2 |
| InChIKey | AWJYZXHFKPILLQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|