C18H26F2N4O2S — CID 123421978
(2R,3S,5R)-5-[5-(amino-methylidene-oxo-λ6-sulfanyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-(2,5-difluorophenyl)oxan-3-amine (PubChem CID 123421978) has the molecular formula C18H26F2N4O2S and a molecular weight of 400.50 g/mol. Its IUPAC name is (2R,3S,5R)-5-[5-(amino-methylidene-oxo-λ6-sulfanyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-(2,5-difluorophenyl)oxan-3-amine.
| Compound Name | (2R,3S,5R)-5-[5-(amino-methylidene-oxo-λ6-sulfanyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-(2,5-difluorophenyl)oxan-3-amine |
|---|---|
| PubChem CID | 123421978 |
| Molecular Formula | C18H26F2N4O2S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | (2R,3S,5R)-5-[5-(amino-methylidene-oxo-λ6-sulfanyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-(2,5-difluorophenyl)oxan-3-amine |
| SMILES | C=S(N)(=O)N1CC2CN([C@H]3CO[C@H](c4cc(F)ccc4F)[C@@H](N)C3)CC2C1 |
| InChI | InChI=1S/C18H26F2N4O2S/c1-27(22,25)24-8-11-6-23(7-12(11)9-24)14-5-17(21)18(26-10-14)15-4-13(19)2-3-16(15)20/h2-4,11-12,14,17-18H,1,5-10,21H2,(H2,22,25)/t11?,12?,14-,17+,18-,27?/m1/s1 |
| InChIKey | ACWUIGATKCVYLU-ILKFYOFXSA-N |
| XLogP | 0.49 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|