C22H31F2N3O — CID 90127842
(2R,3S,5R)-5-[5-(cyclopropylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-2-(2,5-difluorophenyl)oxan-3-amine (PubChem CID 90127842) has the molecular formula C22H31F2N3O and a molecular weight of 391.51 g/mol. Its IUPAC name is (2R,3S,5R)-5-[5-(cyclopropylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-2-(2,5-difluorophenyl)oxan-3-amine.
| Compound Name | (2R,3S,5R)-5-[5-(cyclopropylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-2-(2,5-difluorophenyl)oxan-3-amine |
|---|---|
| PubChem CID | 90127842 |
| Molecular Formula | C22H31F2N3O |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | (2R,3S,5R)-5-[5-(cyclopropylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-2-(2,5-difluorophenyl)oxan-3-amine |
| SMILES | N[C@H]1C[C@@H](N2CC3CCN(CC4CC4)CC3C2)CO[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C22H31F2N3O/c23-17-3-4-20(24)19(7-17)22-21(25)8-18(13-28-22)27-11-15-5-6-26(9-14-1-2-14)10-16(15)12-27/h3-4,7,14-16,18,21-22H,1-2,5-6,8-13,25H2/t15?,16?,18-,21+,22-/m1/s1 |
| InChIKey | NZKZWPATONTXNL-VELILVSXSA-N |
| XLogP | 2.79 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |