C21H30F2N4O — CID 144979156
(2R)-5-(3-tert-butyl-2-methyl-3a,4,6,6a-tetrahydropyrrolo[3,4-d]imidazol-5-yl)-2-(2,5-difluorophenyl)oxan-3-amine (PubChem CID 144979156) has the molecular formula C21H30F2N4O and a molecular weight of 392.49 g/mol. Its IUPAC name is (2R)-5-(3-tert-butyl-2-methyl-3a,4,6,6a-tetrahydropyrrolo[3,4-d]imidazol-5-yl)-2-(2,5-difluorophenyl)oxan-3-amine.
| Compound Name | (2R)-5-(3-tert-butyl-2-methyl-3a,4,6,6a-tetrahydropyrrolo[3,4-d]imidazol-5-yl)-2-(2,5-difluorophenyl)oxan-3-amine |
|---|---|
| PubChem CID | 144979156 |
| Molecular Formula | C21H30F2N4O |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | (2R)-5-(3-tert-butyl-2-methyl-3a,4,6,6a-tetrahydropyrrolo[3,4-d]imidazol-5-yl)-2-(2,5-difluorophenyl)oxan-3-amine |
| SMILES | CC1=NC2CN(C3CO[C@H](c4cc(F)ccc4F)C(N)C3)CC2N1C(C)(C)C |
| InChI | InChI=1S/C21H30F2N4O/c1-12-25-18-9-26(10-19(18)27(12)21(2,3)4)14-8-17(24)20(28-11-14)15-7-13(22)5-6-16(15)23/h5-7,14,17-20H,8-11,24H2,1-4H3/t14?,17?,18?,19?,20-/m1/s1 |
| InChIKey | ZUYVUXCGDPGLKZ-ZUUGNALMSA-N |
| XLogP | 2.71 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |