C21H28F2N4OS — CID 144979076
cyclopentanethiol;(2R)-2-(2,5-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)oxan-3-amine (PubChem CID 144979076) has the molecular formula C21H28F2N4OS and a molecular weight of 422.55 g/mol. Its IUPAC name is cyclopentanethiol;(2R)-2-(2,5-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)oxan-3-amine.
| Compound Name | cyclopentanethiol;(2R)-2-(2,5-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)oxan-3-amine |
|---|---|
| PubChem CID | 144979076 |
| Molecular Formula | C21H28F2N4OS |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | cyclopentanethiol;(2R)-2-(2,5-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)oxan-3-amine |
| SMILES | NC1CC(N2Cc3cn[nH]c3C2)CO[C@@H]1c1cc(F)ccc1F.SC1CCCC1 |
| InChI | InChI=1S/C16H18F2N4O.C5H10S/c17-10-1-2-13(18)12(3-10)16-14(19)4-11(8-23-16)22-6-9-5-20-21-15(9)7-22;6-5-3-1-2-4-5/h1-3,5,11,14,16H,4,6-8,19H2,(H,20,21);5-6H,1-4H2/t11?,14?,16-;/m1./s1 |
| InChIKey | KYISSKLYLCKBLW-OMINDRNZSA-N |
| XLogP | 3.72 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|