C16H26O2S5 — CID 14495949
S-[2-[2-[2-[2-(2-methylprop-2-enoylsulfanyl)ethylsulfanyl]ethylsulfanyl]ethylsulfanyl]ethyl] 2-methylprop-2-enethioate (PubChem CID 14495949) has the molecular formula C16H26O2S5 and a molecular weight of 410.72 g/mol. Its IUPAC name is S-[2-[2-[2-[2-(2-methylprop-2-enoylsulfanyl)ethylsulfanyl]ethylsulfanyl]ethylsulfanyl]ethyl] 2-methylprop-2-enethioate.
| Compound Name | S-[2-[2-[2-[2-(2-methylprop-2-enoylsulfanyl)ethylsulfanyl]ethylsulfanyl]ethylsulfanyl]ethyl] 2-methylprop-2-enethioate |
|---|---|
| PubChem CID | 14495949 |
| Molecular Formula | C16H26O2S5 |
| Molecular Weight | 410.72 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | S-[2-[2-[2-[2-(2-methylprop-2-enoylsulfanyl)ethylsulfanyl]ethylsulfanyl]ethylsulfanyl]ethyl] 2-methylprop-2-enethioate |
| SMILES | C=C(C)C(=O)SCCSCCSCCSCCSC(=O)C(=C)C |
| InChI | InChI=1S/C16H26O2S5/c1-13(2)15(17)22-11-9-20-7-5-19-6-8-21-10-12-23-16(18)14(3)4/h1,3,5-12H2,2,4H3 |
| InChIKey | VYVMOPCPRAGYEY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.72 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|