About 1-methyl-2-penta-1,4-dien-3-ylhydrazine
1-methyl-2-penta-1,4-dien-3-ylhydrazine (PubChem CID 144963768) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is 1-methyl-2-penta-1,4-dien-3-ylhydrazine.
Molecular Properties
| Compound Name | 1-methyl-2-penta-1,4-dien-3-ylhydrazine |
| PubChem CID | 144963768 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 1-methyl-2-penta-1,4-dien-3-ylhydrazine |
| SMILES | C=CC(C=C)NNC |
| InChI | InChI=1S/C6H12N2/c1-4-6(5-2)8-7-3/h4-8H,1-2H2,3H3 |
| InChIKey | BXKAKMFOSBEEGJ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-penta-1,4-dien-3-ylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-penta-1,4-dien-3-ylhydrazine?
The IUPAC name of 1-methyl-2-penta-1,4-dien-3-ylhydrazine (CID 144963768) is 1-methyl-2-penta-1,4-dien-3-ylhydrazine.
What is the SMILES notation for 1-methyl-2-penta-1,4-dien-3-ylhydrazine?
The canonical SMILES for 1-methyl-2-penta-1,4-dien-3-ylhydrazine is C=CC(C=C)NNC.
What is the InChIKey of 1-methyl-2-penta-1,4-dien-3-ylhydrazine?
The InChIKey is BXKAKMFOSBEEGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2/c1-4-6(5-2)8-7-3/h4-8H,1-2H2,3H3.
What are the key properties of 1-methyl-2-penta-1,4-dien-3-ylhydrazine?
1-methyl-2-penta-1,4-dien-3-ylhydrazine has a molecular weight of 112.18 g/mol, XLogP of 0.45, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-penta-1,4-dien-3-ylhydrazine is sourced from PubChem (CID 144963768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).