C5H12N2 — CID 139310279
(2R)-2-N-methylbut-3-ene-1,2-diamine (PubChem CID 139310279) has the molecular formula C5H12N2 and a molecular weight of 100.16 g/mol. Its IUPAC name is (2R)-2-N-methylbut-3-ene-1,2-diamine.
| Compound Name | (2R)-2-N-methylbut-3-ene-1,2-diamine |
|---|---|
| PubChem CID | 139310279 |
| Molecular Formula | C5H12N2 |
| Molecular Weight | 100.16 g/mol |
| Exact Mass | 100.10 |
| IUPAC Name | (2R)-2-N-methylbut-3-ene-1,2-diamine |
| SMILES | C=C[C@H](CN)NC |
| InChI | InChI=1S/C5H12N2/c1-3-5(4-6)7-2/h3,5,7H,1,4,6H2,2H3/t5-/m1/s1 |
| InChIKey | UODYKTAYZUOFBR-RXMQYKEDSA-N |
| XLogP | -0.28 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.16 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|