About N-methylnon-1-en-3-amine
N-methylnon-1-en-3-amine (PubChem CID 91313419) has the molecular formula C10H21N
and a molecular weight of 155.28 g/mol. Its IUPAC name is N-methylnon-1-en-3-amine.
Molecular Properties
| Compound Name | N-methylnon-1-en-3-amine |
| PubChem CID | 91313419 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | N-methylnon-1-en-3-amine |
| SMILES | C=CC(CCCCCC)NC |
| InChI | InChI=1S/C10H21N/c1-4-6-7-8-9-10(5-2)11-3/h5,10-11H,2,4,6-9H2,1,3H3 |
| InChIKey | QQFHUCUTBRHKEB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-methylnon-1-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylnon-1-en-3-amine?
The IUPAC name of N-methylnon-1-en-3-amine (CID 91313419) is N-methylnon-1-en-3-amine.
What is the SMILES notation for N-methylnon-1-en-3-amine?
The canonical SMILES for N-methylnon-1-en-3-amine is C=CC(CCCCCC)NC.
What is the InChIKey of N-methylnon-1-en-3-amine?
The InChIKey is QQFHUCUTBRHKEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N/c1-4-6-7-8-9-10(5-2)11-3/h5,10-11H,2,4,6-9H2,1,3H3.
What are the key properties of N-methylnon-1-en-3-amine?
N-methylnon-1-en-3-amine has a molecular weight of 155.28 g/mol, XLogP of 2.73, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylnon-1-en-3-amine is sourced from PubChem (CID 91313419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).