C18H16BrN5O2S — CID 144964220
3-N-(6-bromo-7-cyclohexa-1,3-dien-1-ylsulfonylpyrrolo[2,3-d]pyrimidin-4-yl)benzene-1,3-diamine (PubChem CID 144964220) has the molecular formula C18H16BrN5O2S and a molecular weight of 446.33 g/mol. Its IUPAC name is 3-N-(6-bromo-7-cyclohexa-1,3-dien-1-ylsulfonylpyrrolo[2,3-d]pyrimidin-4-yl)benzene-1,3-diamine.
| Compound Name | 3-N-(6-bromo-7-cyclohexa-1,3-dien-1-ylsulfonylpyrrolo[2,3-d]pyrimidin-4-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 144964220 |
| Molecular Formula | C18H16BrN5O2S |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 3-N-(6-bromo-7-cyclohexa-1,3-dien-1-ylsulfonylpyrrolo[2,3-d]pyrimidin-4-yl)benzene-1,3-diamine |
| SMILES | Nc1cccc(Nc2ncnc3c2cc(Br)n3S(=O)(=O)C2=CC=CCC2)c1 |
| InChI | InChI=1S/C18H16BrN5O2S/c19-16-10-15-17(23-13-6-4-5-12(20)9-13)21-11-22-18(15)24(16)27(25,26)14-7-2-1-3-8-14/h1-2,4-7,9-11H,3,8,20H2,(H,21,22,23) |
| InChIKey | PWHDOFQAIIEWHB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|