C14H29NO2S — CID 144966152
N-[(E)-5,7-dimethyloct-5-en-3-yl]-2-methylpropane-2-sulfonamide (PubChem CID 144966152) has the molecular formula C14H29NO2S and a molecular weight of 275.46 g/mol. Its IUPAC name is N-[(E)-5,7-dimethyloct-5-en-3-yl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[(E)-5,7-dimethyloct-5-en-3-yl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 144966152 |
| Molecular Formula | C14H29NO2S |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | N-[(E)-5,7-dimethyloct-5-en-3-yl]-2-methylpropane-2-sulfonamide |
| SMILES | CCC(C/C(C)=C/C(C)C)NS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C14H29NO2S/c1-8-13(10-12(4)9-11(2)3)15-18(16,17)14(5,6)7/h9,11,13,15H,8,10H2,1-7H3/b12-9+ |
| InChIKey | GRDMCZQMRIHMSD-FMIVXFBMSA-N |
| XLogP | 3.48 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|