C17H25ClN2O3S — CID 144967187
2-tert-butyl-6-chloro-7-pyrrolidin-1-ylsulfonyl-1,3-benzoxazole;ethane (PubChem CID 144967187) has the molecular formula C17H25ClN2O3S and a molecular weight of 372.92 g/mol. Its IUPAC name is 2-tert-butyl-6-chloro-7-pyrrolidin-1-ylsulfonyl-1,3-benzoxazole;ethane.
| Compound Name | 2-tert-butyl-6-chloro-7-pyrrolidin-1-ylsulfonyl-1,3-benzoxazole;ethane |
|---|---|
| PubChem CID | 144967187 |
| Molecular Formula | C17H25ClN2O3S |
| Molecular Weight | 372.92 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 2-tert-butyl-6-chloro-7-pyrrolidin-1-ylsulfonyl-1,3-benzoxazole;ethane |
| SMILES | CC.CC(C)(C)c1nc2ccc(Cl)c(S(=O)(=O)N3CCCC3)c2o1 |
| InChI | InChI=1S/C15H19ClN2O3S.C2H6/c1-15(2,3)14-17-11-7-6-10(16)13(12(11)21-14)22(19,20)18-8-4-5-9-18;1-2/h6-7H,4-5,8-9H2,1-3H3;1-2H3 |
| InChIKey | NSFGJRJXQVBPIR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.92 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |