C42H34N4 — CID 144968022
(2E)-N-(1-phenylethylidene)-N'-[1-(11-phenylindolo[2,3-a]carbazol-12-yl)ethenyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide (PubChem CID 144968022) has the molecular formula C42H34N4 and a molecular weight of 594.76 g/mol. Its IUPAC name is (2E)-N-(1-phenylethylidene)-N'-[1-(11-phenylindolo[2,3-a]carbazol-12-yl)ethenyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide.
| Compound Name | (2E)-N-(1-phenylethylidene)-N'-[1-(11-phenylindolo[2,3-a]carbazol-12-yl)ethenyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide |
|---|---|
| PubChem CID | 144968022 |
| Molecular Formula | C42H34N4 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | (2E)-N-(1-phenylethylidene)-N'-[1-(11-phenylindolo[2,3-a]carbazol-12-yl)ethenyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide |
| SMILES | C=C/C=C(\C=C/C)C(=N/C(=C)n1c2ccccc2c2ccc3c4ccccc4n(-c4ccccc4)c3c21)/N=C(\C)c1ccccc1 |
| InChI | InChI=1S/C42H34N4/c1-5-17-32(18-6-2)42(43-29(3)31-19-9-7-10-20-31)44-30(4)45-38-25-15-13-23-34(38)36-27-28-37-35-24-14-16-26-39(35)46(41(37)40(36)45)33-21-11-8-12-22-33/h5-28H,1,4H2,2-3H3/b18-6-,32-17+,43-29+,44-42- |
| InChIKey | OKYFVBCJJRXZLP-RYQUVFRSSA-N |
| XLogP | 10.92 |
| TPSA | 34.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|