C16H21N3 — CID 144968713
3-[[5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1H-imidazol-2-yl]methyl]-6-azabicyclo[3.1.1]heptane (PubChem CID 144968713) has the molecular formula C16H21N3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 3-[[5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1H-imidazol-2-yl]methyl]-6-azabicyclo[3.1.1]heptane.
| Compound Name | 3-[[5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1H-imidazol-2-yl]methyl]-6-azabicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 144968713 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 3-[[5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1H-imidazol-2-yl]methyl]-6-azabicyclo[3.1.1]heptane |
| SMILES | C=C/C=C\c1[nH]c(CC2CC3CC(C2)N3)nc1C=C |
| InChI | InChI=1S/C16H21N3/c1-3-5-6-15-14(4-2)18-16(19-15)9-11-7-12-10-13(8-11)17-12/h3-6,11-13,17H,1-2,7-10H2,(H,18,19)/b6-5- |
| InChIKey | LLBWDNDIJVAOJM-WAYWQWQTSA-N |
| XLogP | 2.93 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|